About [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate
[(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate (PubChem CID 11289225) has the molecular formula C14H28O4Si
and a molecular weight of 288.46 g/mol. Its IUPAC name is [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate.
Molecular Properties
| Compound Name | [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate |
| PubChem CID | 11289225 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H28O4Si/c1-10(15)17-12-7-11(16)8-13(9-12)18-19(5,6)14(2,3)4/h11-13,16H,7-9H2,1-6H3/t11-,12+,13-/m0/s1 |
| InChIKey | HQZZZBAXPMRXNA-XQQFMLRXSA-N |
| XLogP | 2.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate?
The IUPAC name of [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate (CID 11289225) is [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate.
What is the SMILES notation for [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate?
The canonical SMILES for [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate is CC(=O)O[C@@H]1C[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)C1.
What is the InChIKey of [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate?
The InChIKey is HQZZZBAXPMRXNA-XQQFMLRXSA-N. The full InChI is InChI=1S/C14H28O4Si/c1-10(15)17-12-7-11(16)8-13(9-12)18-19(5,6)14(2,3)4/h11-13,16H,7-9H2,1-6H3/t11-,12+,13-/m0/s1.
What are the key properties of [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate?
[(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate has a molecular weight of 288.46 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxycyclohexyl] acetate is sourced from PubChem (CID 11289225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).