C18H26O3 — CID 11289282
(5S)-5-hydroxy-5-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]furan-2-one (PubChem CID 11289282) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (5S)-5-hydroxy-5-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]furan-2-one.
| Compound Name | (5S)-5-hydroxy-5-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]furan-2-one |
|---|---|
| PubChem CID | 11289282 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (5S)-5-hydroxy-5-[(2Z,5Z,8Z)-tetradeca-2,5,8-trienyl]furan-2-one |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C[C@@]1(O)C=CC(=O)O1 |
| InChI | InChI=1S/C18H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(20)16-14-17(19)21-18/h6-7,9-10,12-14,16,20H,2-5,8,11,15H2,1H3/b7-6-,10-9-,13-12-/t18-/m0/s1 |
| InChIKey | LVCOGODTZXUSJZ-ASAJVGERSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|