C17H26O2Si — CID 11289292
(1R,2S,5S,6R,7S)-5-[(Z)-5-trimethylsilylpent-3-enyl]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11289292) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (1R,2S,5S,6R,7S)-5-[(Z)-5-trimethylsilylpent-3-enyl]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1R,2S,5S,6R,7S)-5-[(Z)-5-trimethylsilylpent-3-enyl]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11289292 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (1R,2S,5S,6R,7S)-5-[(Z)-5-trimethylsilylpent-3-enyl]-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | C[Si](C)(C)C/C=C\CC[C@@H]1OC(=O)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C17H26O2Si/c1-20(2,3)10-6-4-5-7-14-15-12-8-9-13(11-12)16(15)17(18)19-14/h4,6,8-9,12-16H,5,7,10-11H2,1-3H3/b6-4-/t12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | MSQHEUSPYPNLLF-BYVFYBESSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|