About 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol
1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol (PubChem CID 11289317) has the molecular formula C15H25N5O
and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol.
Molecular Properties
| Compound Name | 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol |
| PubChem CID | 11289317 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol |
| SMILES | CCCCCCCCC(O)Cn1cc2c(N)ncnc2n1 |
| InChI | InChI=1S/C15H25N5O/c1-2-3-4-5-6-7-8-12(21)9-20-10-13-14(16)17-11-18-15(13)19-20/h10-12,21H,2-9H2,1H3,(H2,16,17,18,19) |
| InChIKey | AHEGQNDGYVLQET-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol?
The IUPAC name of 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol (CID 11289317) is 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol.
What is the SMILES notation for 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol?
The canonical SMILES for 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol is CCCCCCCCC(O)Cn1cc2c(N)ncnc2n1.
What is the InChIKey of 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol?
The InChIKey is AHEGQNDGYVLQET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5O/c1-2-3-4-5-6-7-8-12(21)9-20-10-13-14(16)17-11-18-15(13)19-20/h10-12,21H,2-9H2,1H3,(H2,16,17,18,19).
What are the key properties of 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol?
1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol has a molecular weight of 291.40 g/mol, XLogP of 2.52, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)decan-2-ol is sourced from PubChem (CID 11289317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).