C18H17N5O2 — CID 112893506
methyl 3-[[4-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112893506) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is methyl 3-[[4-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 3-[[4-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112893506 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 3-[[4-(pyridin-3-ylmethylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nccc(NCc3cccnc3)n2)c1 |
| InChI | InChI=1S/C18H17N5O2/c1-25-17(24)14-5-2-6-15(10-14)22-18-20-9-7-16(23-18)21-12-13-4-3-8-19-11-13/h2-11H,12H2,1H3,(H2,20,21,22,23) |
| InChIKey | NLIQXRMZKMVDJK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |