C17H28O4 — CID 11289461
(3R,4aR,8R,8aR)-3-[(1S)-1-(methoxymethoxy)ethyl]-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one (PubChem CID 11289461) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3R,4aR,8R,8aR)-3-[(1S)-1-(methoxymethoxy)ethyl]-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one.
| Compound Name | (3R,4aR,8R,8aR)-3-[(1S)-1-(methoxymethoxy)ethyl]-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 11289461 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3R,4aR,8R,8aR)-3-[(1S)-1-(methoxymethoxy)ethyl]-5-methyl-8-propan-2-yl-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
| SMILES | COCO[C@@H](C)[C@H]1C[C@H]2C(C)=CC[C@H](C(C)C)[C@H]2C(=O)O1 |
| InChI | InChI=1S/C17H28O4/c1-10(2)13-7-6-11(3)14-8-15(12(4)20-9-19-5)21-17(18)16(13)14/h6,10,12-16H,7-9H2,1-5H3/t12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | CFMIHADCHPMPTH-ZVDSWSACSA-N |
| XLogP | 3.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|