About tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate
tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 11289484) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 11289484 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1COC(c2cccc3ccccc23)=N1 |
| InChI | InChI=1S/C18H19NO3/c1-18(2,3)22-17(20)15-11-21-16(19-15)14-10-6-8-12-7-4-5-9-13(12)14/h4-10,15H,11H2,1-3H3 |
| InChIKey | VNGIOJOABFGZRL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 11289484) is tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate is CC(C)(C)OC(=O)C1COC(c2cccc3ccccc23)=N1.
What is the InChIKey of tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is VNGIOJOABFGZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-18(2,3)22-17(20)15-11-21-16(19-15)14-10-6-8-12-7-4-5-9-13(12)14/h4-10,15H,11H2,1-3H3.
What are the key properties of tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate?
tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 297.35 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-naphthalen-1-yl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 11289484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).