C20H28N4O — CID 112895253
4-N-cycloheptyl-2-N-[2-(3-methoxyphenyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112895253) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-N-cycloheptyl-2-N-[2-(3-methoxyphenyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-cycloheptyl-2-N-[2-(3-methoxyphenyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112895253 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-N-cycloheptyl-2-N-[2-(3-methoxyphenyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | COc1cccc(CCNc2nccc(NC3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C20H28N4O/c1-25-18-10-6-7-16(15-18)11-13-21-20-22-14-12-19(24-20)23-17-8-4-2-3-5-9-17/h6-7,10,12,14-15,17H,2-5,8-9,11,13H2,1H3,(H2,21,22,23,24) |
| InChIKey | KLJXPPCFRCVDTP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |