C17H34N2O2 — CID 11289532
(2R,4S,5S)-5-amino-N-butyl-6-cyclohexyl-4-hydroxy-2-methylhexanamide (PubChem CID 11289532) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-N-butyl-6-cyclohexyl-4-hydroxy-2-methylhexanamide.
| Compound Name | (2R,4S,5S)-5-amino-N-butyl-6-cyclohexyl-4-hydroxy-2-methylhexanamide |
|---|---|
| PubChem CID | 11289532 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | (2R,4S,5S)-5-amino-N-butyl-6-cyclohexyl-4-hydroxy-2-methylhexanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C17H34N2O2/c1-3-4-10-19-17(21)13(2)11-16(20)15(18)12-14-8-6-5-7-9-14/h13-16,20H,3-12,18H2,1-2H3,(H,19,21)/t13-,15+,16+/m1/s1 |
| InChIKey | IODQQCZNYSEROJ-KBMXLJTQSA-N |
| XLogP | 2.59 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|