C21H25N5O2 — CID 112897265
4-N-[(3,4-dimethoxyphenyl)methyl]-2-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine (PubChem CID 112897265) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-N-[(3,4-dimethoxyphenyl)methyl]-2-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3,4-dimethoxyphenyl)methyl]-2-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112897265 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-N-[(3,4-dimethoxyphenyl)methyl]-2-N-[4-(dimethylamino)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccc(CNc2ccnc(Nc3ccc(N(C)C)cc3)n2)cc1OC |
| InChI | InChI=1S/C21H25N5O2/c1-26(2)17-8-6-16(7-9-17)24-21-22-12-11-20(25-21)23-14-15-5-10-18(27-3)19(13-15)28-4/h5-13H,14H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | CWBPQTAZLPTFSM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|