C21H22O2 — CID 11289756
2-[(1S,2R)-2-benzoylcyclohexyl]-1-phenylethanone (PubChem CID 11289756) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[(1S,2R)-2-benzoylcyclohexyl]-1-phenylethanone.
| Compound Name | 2-[(1S,2R)-2-benzoylcyclohexyl]-1-phenylethanone |
|---|---|
| PubChem CID | 11289756 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(1S,2R)-2-benzoylcyclohexyl]-1-phenylethanone |
| SMILES | O=C(C[C@@H]1CCCC[C@H]1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H22O2/c22-20(16-9-3-1-4-10-16)15-18-13-7-8-14-19(18)21(23)17-11-5-2-6-12-17/h1-6,9-12,18-19H,7-8,13-15H2/t18-,19+/m0/s1 |
| InChIKey | QGVGJFFMNAOJGB-RBUKOAKNSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |