C13H16N4O5 — CID 11289797
(2S,3S,4S,5R,6S)-6-azido-3,4,5-trihydroxy-N-methyl-N-phenyloxane-2-carboxamide (PubChem CID 11289797) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-azido-3,4,5-trihydroxy-N-methyl-N-phenyloxane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R,6S)-6-azido-3,4,5-trihydroxy-N-methyl-N-phenyloxane-2-carboxamide |
|---|---|
| PubChem CID | 11289797 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-azido-3,4,5-trihydroxy-N-methyl-N-phenyloxane-2-carboxamide |
| SMILES | CN(C(=O)[C@H]1O[C@H](N=[N+]=[N-])[C@H](O)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C13H16N4O5/c1-17(7-5-3-2-4-6-7)13(21)11-9(19)8(18)10(20)12(22-11)15-16-14/h2-6,8-12,18-20H,1H3/t8-,9-,10+,11-,12-/m0/s1 |
| InChIKey | UUNGTEDRLJBDMN-SVNGYHJRSA-N |
| XLogP | -0.23 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|