C19H24N2O2 — CID 11289935
3-[[3-ethyl-5-[ethyl(methyl)amino]-2-methyl-6-oxo-1H-pyridin-4-yl]methyl]benzaldehyde (PubChem CID 11289935) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3-[[3-ethyl-5-[ethyl(methyl)amino]-2-methyl-6-oxo-1H-pyridin-4-yl]methyl]benzaldehyde.
| Compound Name | 3-[[3-ethyl-5-[ethyl(methyl)amino]-2-methyl-6-oxo-1H-pyridin-4-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 11289935 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[[3-ethyl-5-[ethyl(methyl)amino]-2-methyl-6-oxo-1H-pyridin-4-yl]methyl]benzaldehyde |
| SMILES | CCc1c(C)[nH]c(=O)c(N(C)CC)c1Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-5-16-13(3)20-19(23)18(21(4)6-2)17(16)11-14-8-7-9-15(10-14)12-22/h7-10,12H,5-6,11H2,1-4H3,(H,20,23) |
| InChIKey | WWIWUVABYGXKRJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|