About 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline
4-chloro-6,7-bis(2-methoxyethoxy)quinazoline (PubChem CID 11289942) has the molecular formula C14H17ClN2O4
and a molecular weight of 312.75 g/mol. Its IUPAC name is 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline.
Molecular Properties
| Compound Name | 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline |
| PubChem CID | 11289942 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline |
| SMILES | COCCOc1cc2ncnc(Cl)c2cc1OCCOC |
| InChI | InChI=1S/C14H17ClN2O4/c1-18-3-5-20-12-7-10-11(16-9-17-14(10)15)8-13(12)21-6-4-19-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | ZPJLDMNVDPGZIU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline?
The IUPAC name of 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline (CID 11289942) is 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline.
What is the SMILES notation for 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline?
The canonical SMILES for 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline is COCCOc1cc2ncnc(Cl)c2cc1OCCOC.
What is the InChIKey of 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline?
The InChIKey is ZPJLDMNVDPGZIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O4/c1-18-3-5-20-12-7-10-11(16-9-17-14(10)15)8-13(12)21-6-4-19-2/h7-9H,3-6H2,1-2H3.
What are the key properties of 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline?
4-chloro-6,7-bis(2-methoxyethoxy)quinazoline has a molecular weight of 312.75 g/mol, XLogP of 2.33, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-bis(2-methoxyethoxy)quinazoline is sourced from PubChem (CID 11289942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).