C19H17F3N4 — CID 112899437
2-N-(3-phenylpropyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine (PubChem CID 112899437) has the molecular formula C19H17F3N4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-N-(3-phenylpropyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-phenylpropyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899437 |
| Molecular Formula | C19H17F3N4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-N-(3-phenylpropyl)-4-N-(2,3,4-trifluorophenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1ccc(Nc2ccnc(NCCCc3ccccc3)n2)c(F)c1F |
| InChI | InChI=1S/C19H17F3N4/c20-14-8-9-15(18(22)17(14)21)25-16-10-12-24-19(26-16)23-11-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-10,12H,4,7,11H2,(H2,23,24,25,26) |
| InChIKey | ZKXOPKWZXMLMDY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|