C14H26Sn — CID 11289944
[(2Z,4E,6E)-4,6-dimethylnona-2,4,6-trien-2-yl]-trimethylstannane (PubChem CID 11289944) has the molecular formula C14H26Sn and a molecular weight of 313.07 g/mol. Its IUPAC name is [(2Z,4E,6E)-4,6-dimethylnona-2,4,6-trien-2-yl]-trimethylstannane.
| Compound Name | [(2Z,4E,6E)-4,6-dimethylnona-2,4,6-trien-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 11289944 |
| Molecular Formula | C14H26Sn |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(2Z,4E,6E)-4,6-dimethylnona-2,4,6-trien-2-yl]-trimethylstannane |
| SMILES | CC/C=C(C)/C=C(C)/C=C(/C)[Sn](C)(C)C |
| InChI | InChI=1S/C11H17.3CH3.Sn/c1-5-7-10(3)9-11(4)8-6-2;;;;/h7-9H,5H2,1-4H3;3*1H3;/b8-6?,10-7+,11-9+;;;; |
| InChIKey | DKTRAIJYOKKEAN-WATBBGSYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|