C17H24N4 — CID 112899705
4-N-tert-butyl-2-N-(2-propan-2-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112899705) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N-(2-propan-2-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-tert-butyl-2-N-(2-propan-2-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899705 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-tert-butyl-2-N-(2-propan-2-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)c1ccccc1Nc1nccc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C17H24N4/c1-12(2)13-8-6-7-9-14(13)19-16-18-11-10-15(20-16)21-17(3,4)5/h6-12H,1-5H3,(H2,18,19,20,21) |
| InChIKey | FPQBGFQQGWFYPV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |