C14H16Cl2N4 — CID 112899778
4-N-tert-butyl-2-N-(3,4-dichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 112899778) has the molecular formula C14H16Cl2N4 and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-N-tert-butyl-2-N-(3,4-dichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-tert-butyl-2-N-(3,4-dichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112899778 |
| Molecular Formula | C14H16Cl2N4 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-N-tert-butyl-2-N-(3,4-dichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)(C)Nc1ccnc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H16Cl2N4/c1-14(2,3)20-12-6-7-17-13(19-12)18-9-4-5-10(15)11(16)8-9/h4-8H,1-3H3,(H2,17,18,19,20) |
| InChIKey | UCQZNJWBKCRPQW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |