C15H30O3Si2 — CID 11290005
[(1Z,3E)-1-ethoxy-3-trimethylsilyloxyhepta-1,3,6-trienoxy]-trimethylsilane (PubChem CID 11290005) has the molecular formula C15H30O3Si2 and a molecular weight of 314.57 g/mol. Its IUPAC name is [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyhepta-1,3,6-trienoxy]-trimethylsilane.
| Compound Name | [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyhepta-1,3,6-trienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11290005 |
| Molecular Formula | C15H30O3Si2 |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [(1Z,3E)-1-ethoxy-3-trimethylsilyloxyhepta-1,3,6-trienoxy]-trimethylsilane |
| SMILES | C=CC/C=C(\C=C(\OCC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O3Si2/c1-9-11-12-14(17-19(3,4)5)13-15(16-10-2)18-20(6,7)8/h9,12-13H,1,10-11H2,2-8H3/b14-12+,15-13- |
| InChIKey | YGRLWVJNBUSYIJ-GQJHWZHGSA-N |
| XLogP | 5.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|