C22H24N4O2 — CID 112900117
methyl 4-[[2-[benzyl(propan-2-yl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 112900117) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is methyl 4-[[2-[benzyl(propan-2-yl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[2-[benzyl(propan-2-yl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112900117 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | methyl 4-[[2-[benzyl(propan-2-yl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccnc(N(Cc3ccccc3)C(C)C)n2)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-16(2)26(15-17-7-5-4-6-8-17)22-23-14-13-20(25-22)24-19-11-9-18(10-12-19)21(27)28-3/h4-14,16H,15H2,1-3H3,(H,23,24,25) |
| InChIKey | FFOLIBFLAKXJJO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |