C15H18F2N4 — CID 112900250
2-N-(2,6-difluorophenyl)-4-N-(3-methylbutyl)pyrimidine-2,4-diamine (PubChem CID 112900250) has the molecular formula C15H18F2N4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-N-(2,6-difluorophenyl)-4-N-(3-methylbutyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,6-difluorophenyl)-4-N-(3-methylbutyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112900250 |
| Molecular Formula | C15H18F2N4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-N-(2,6-difluorophenyl)-4-N-(3-methylbutyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)CCNc1ccnc(Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C15H18F2N4/c1-10(2)6-8-18-13-7-9-19-15(20-13)21-14-11(16)4-3-5-12(14)17/h3-5,7,9-10H,6,8H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | VBRXLUWXECNTKH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |