C16H14N6O2 — CID 11290216
4,6-diamino-2-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 11290216) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 4,6-diamino-2-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4,6-diamino-2-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 11290216 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4,6-diamino-2-(4-methoxyphenyl)-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | COc1ccc(-n2nc3c(N)nc4c(N)cccc4n3c2=O)cc1 |
| InChI | InChI=1S/C16H14N6O2/c1-24-10-7-5-9(6-8-10)22-16(23)21-12-4-2-3-11(17)13(12)19-14(18)15(21)20-22/h2-8H,17H2,1H3,(H2,18,19) |
| InChIKey | JNRCICWEAQCTEH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|