C16H19F3N2O2 — CID 11290377
(2S,5R)-3,6-dimethoxy-2-propan-2-yl-5-[(2,4,5-trifluorophenyl)methyl]-2,5-dihydropyrazine (PubChem CID 11290377) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is (2S,5R)-3,6-dimethoxy-2-propan-2-yl-5-[(2,4,5-trifluorophenyl)methyl]-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-3,6-dimethoxy-2-propan-2-yl-5-[(2,4,5-trifluorophenyl)methyl]-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 11290377 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S,5R)-3,6-dimethoxy-2-propan-2-yl-5-[(2,4,5-trifluorophenyl)methyl]-2,5-dihydropyrazine |
| SMILES | COC1=N[C@H](Cc2cc(F)c(F)cc2F)C(OC)=N[C@H]1C(C)C |
| InChI | InChI=1S/C16H19F3N2O2/c1-8(2)14-16(23-4)20-13(15(21-14)22-3)6-9-5-11(18)12(19)7-10(9)17/h5,7-8,13-14H,6H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | PFDZQKDQCHLUNL-KGLIPLIRSA-N |
| XLogP | 3.14 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|