C19H17ClN4O — CID 112904094
1-[3-[[2-(3-chloro-4-methylanilino)pyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112904094) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-[3-[[2-(3-chloro-4-methylanilino)pyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[2-(3-chloro-4-methylanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112904094 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[3-[[2-(3-chloro-4-methylanilino)pyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ccnc(Nc3ccc(C)c(Cl)c3)n2)c1 |
| InChI | InChI=1S/C19H17ClN4O/c1-12-6-7-16(11-17(12)20)23-19-21-9-8-18(24-19)22-15-5-3-4-14(10-15)13(2)25/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | XRTDSIPUGRQGBT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |