C19H17ClN4O3 — CID 112904407
methyl 2-[[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112904407) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is methyl 2-[[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112904407 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | methyl 2-[[2-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ccnc(Nc2cc(Cl)ccc2OC)n1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-26-16-8-7-12(20)11-15(16)23-19-21-10-9-17(24-19)22-14-6-4-3-5-13(14)18(25)27-2/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | XPYNFUNPIUWBLV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |