C17H20O5Si — CID 11290502
dimethyl (1R,8R)-1-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 11290502) has the molecular formula C17H20O5Si and a molecular weight of 332.43 g/mol. Its IUPAC name is dimethyl (1R,8R)-1-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8R)-1-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 11290502 |
| Molecular Formula | C17H20O5Si |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | dimethyl (1R,8R)-1-trimethylsilyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2([Si](C)(C)C)O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C17H20O5Si/c1-20-15(18)12-13(16(19)21-2)17(23(3,4)5)11-9-7-6-8-10(11)14(12)22-17/h6-9,14H,1-5H3/t14-,17-/m1/s1 |
| InChIKey | UVHDSZCOEZXKBE-RHSMWYFYSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|