C18H13ClF2N4O2 — CID 112906031
methyl 4-chloro-3-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112906031) has the molecular formula C18H13ClF2N4O2 and a molecular weight of 390.78 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112906031 |
| Molecular Formula | C18H13ClF2N4O2 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl 4-chloro-3-[[4-(2,6-difluoroanilino)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2nccc(Nc3c(F)cccc3F)n2)c1 |
| InChI | InChI=1S/C18H13ClF2N4O2/c1-27-17(26)10-5-6-11(19)14(9-10)23-18-22-8-7-15(25-18)24-16-12(20)3-2-4-13(16)21/h2-9H,1H3,(H2,22,23,24,25) |
| InChIKey | ZEAYDKHQHSVLOD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |