C19H26ClNO2 — CID 11290618
(3S,4S)-4-(2-chloropropan-2-yl)-1-cyclohexyl-3-phenylmethoxyazetidin-2-one (PubChem CID 11290618) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is (3S,4S)-4-(2-chloropropan-2-yl)-1-cyclohexyl-3-phenylmethoxyazetidin-2-one.
| Compound Name | (3S,4S)-4-(2-chloropropan-2-yl)-1-cyclohexyl-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 11290618 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3S,4S)-4-(2-chloropropan-2-yl)-1-cyclohexyl-3-phenylmethoxyazetidin-2-one |
| SMILES | CC(C)(Cl)[C@@H]1[C@H](OCc2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C19H26ClNO2/c1-19(2,20)17-16(23-13-14-9-5-3-6-10-14)18(22)21(17)15-11-7-4-8-12-15/h3,5-6,9-10,15-17H,4,7-8,11-13H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | FUXKSTMRYSXTHK-IRXDYDNUSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|