C18H32O4Si — CID 11290772
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxolan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one (PubChem CID 11290772) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxolan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one.
| Compound Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxolan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one |
|---|---|
| PubChem CID | 11290772 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxolan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-one |
| SMILES | CC1=C(C2OCCO2)C(C)(C)C(=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O4Si/c1-12-13(22-23(7,8)17(2,3)4)11-14(19)18(5,6)15(12)16-20-9-10-21-16/h13,16H,9-11H2,1-8H3/t13-/m0/s1 |
| InChIKey | VIVGPZIVJWOKGU-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|