About 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole
2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole (PubChem CID 11290806) has the molecular formula C14H10BrF2NS
and a molecular weight of 342.21 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole |
| PubChem CID | 11290806 |
| Molecular Formula | C14H10BrF2NS |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C14H10BrF2NS/c15-13-7-6-12(19-13)10-4-5-11(18-10)14-8(16)2-1-3-9(14)17/h1-3,6-7,10H,4-5H2 |
| InChIKey | AFGVKTHLPGYTKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole?
The IUPAC name of 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole (CID 11290806) is 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole is Fc1cccc(F)c1C1=NC(c2ccc(Br)s2)CC1.
What is the InChIKey of 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole?
The InChIKey is AFGVKTHLPGYTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2NS/c15-13-7-6-12(19-13)10-4-5-11(18-10)14-8(16)2-1-3-9(14)17/h1-3,6-7,10H,4-5H2.
What are the key properties of 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole?
2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole has a molecular weight of 342.21 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromothiophen-2-yl)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 11290806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).