C19H28N4 — CID 112908185
4-N-butyl-2-N-(2-tert-butylphenyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 112908185) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-N-butyl-2-N-(2-tert-butylphenyl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-2-N-(2-tert-butylphenyl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112908185 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 4-N-butyl-2-N-(2-tert-butylphenyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(C)nc(Nc2ccccc2C(C)(C)C)n1 |
| InChI | InChI=1S/C19H28N4/c1-6-7-12-20-17-13-14(2)21-18(23-17)22-16-11-9-8-10-15(16)19(3,4)5/h8-11,13H,6-7,12H2,1-5H3,(H2,20,21,22,23) |
| InChIKey | QXPQCIGYPMLKJH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|