C21H42O3 — CID 11290828
1,17-dihydroxy-2,2,16,16-tetramethylheptadecan-9-one (PubChem CID 11290828) has the molecular formula C21H42O3 and a molecular weight of 342.56 g/mol. Its IUPAC name is 1,17-dihydroxy-2,2,16,16-tetramethylheptadecan-9-one.
| Compound Name | 1,17-dihydroxy-2,2,16,16-tetramethylheptadecan-9-one |
|---|---|
| PubChem CID | 11290828 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 1,17-dihydroxy-2,2,16,16-tetramethylheptadecan-9-one |
| SMILES | CC(C)(CO)CCCCCCC(=O)CCCCCCC(C)(C)CO |
| InChI | InChI=1S/C21H42O3/c1-20(2,17-22)15-11-7-5-9-13-19(24)14-10-6-8-12-16-21(3,4)18-23/h22-23H,5-18H2,1-4H3 |
| InChIKey | HCAHNSOHEXNCTF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|