C22H20NOP — CID 11290909
(E,E)-N-diphenylphosphoryl-4-phenylbut-3-en-2-imine (PubChem CID 11290909) has the molecular formula C22H20NOP and a molecular weight of 345.38 g/mol. Its IUPAC name is (E,E)-N-diphenylphosphoryl-4-phenylbut-3-en-2-imine.
| Compound Name | (E,E)-N-diphenylphosphoryl-4-phenylbut-3-en-2-imine |
|---|---|
| PubChem CID | 11290909 |
| Molecular Formula | C22H20NOP |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (E,E)-N-diphenylphosphoryl-4-phenylbut-3-en-2-imine |
| SMILES | CC(/C=C/c1ccccc1)=N\P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20NOP/c1-19(17-18-20-11-5-2-6-12-20)23-25(24,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,1H3/b18-17+,23-19+ |
| InChIKey | RQTXKWDBLSKRFB-IFGWPPESSA-N |
| XLogP | 5.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|