About N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide
N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide (PubChem CID 11290921) has the molecular formula C22H23N3O
and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide.
Molecular Properties
| Compound Name | N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide |
| PubChem CID | 11290921 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O/c1-3-16(4-2)21(26)25-22-23-19(17-11-7-5-8-12-17)15-20(24-22)18-13-9-6-10-14-18/h5-16H,3-4H2,1-2H3,(H,23,24,25,26) |
| InChIKey | YOARGGKKYZIYSU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide?
The IUPAC name of N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide (CID 11290921) is N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide.
What is the SMILES notation for N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide?
The canonical SMILES for N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide is CCC(CC)C(=O)Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1.
What is the InChIKey of N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide?
The InChIKey is YOARGGKKYZIYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O/c1-3-16(4-2)21(26)25-22-23-19(17-11-7-5-8-12-17)15-20(24-22)18-13-9-6-10-14-18/h5-16H,3-4H2,1-2H3,(H,23,24,25,26).
What are the key properties of N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide?
N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide has a molecular weight of 345.45 g/mol, XLogP of 5.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-diphenylpyrimidin-2-yl)-2-ethylbutanamide is sourced from PubChem (CID 11290921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).