C15H24N4 — CID 112909491
4-methyl-6-(3-methylpiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine (PubChem CID 112909491) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-methyl-6-(3-methylpiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-methyl-6-(3-methylpiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 112909491 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4-methyl-6-(3-methylpiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine |
| SMILES | Cc1cc(N2CCCC(C)C2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H24N4/c1-12-6-5-9-19(11-12)14-10-13(2)16-15(17-14)18-7-3-4-8-18/h10,12H,3-9,11H2,1-2H3 |
| InChIKey | XMBLVULOCXAODR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |