C19H30O4Si — CID 11291050
(4S,4aS,8aS)-8a-hydroxy-4-tri(propan-2-yl)silyloxy-4a,5-dihydro-4H-naphthalene-1,8-dione (PubChem CID 11291050) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (4S,4aS,8aS)-8a-hydroxy-4-tri(propan-2-yl)silyloxy-4a,5-dihydro-4H-naphthalene-1,8-dione.
| Compound Name | (4S,4aS,8aS)-8a-hydroxy-4-tri(propan-2-yl)silyloxy-4a,5-dihydro-4H-naphthalene-1,8-dione |
|---|---|
| PubChem CID | 11291050 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (4S,4aS,8aS)-8a-hydroxy-4-tri(propan-2-yl)silyloxy-4a,5-dihydro-4H-naphthalene-1,8-dione |
| SMILES | CC(C)[Si](O[C@H]1C=CC(=O)[C@@]2(O)C(=O)C=CC[C@@H]12)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H30O4Si/c1-12(2)24(13(3)4,14(5)6)23-16-10-11-18(21)19(22)15(16)8-7-9-17(19)20/h7,9-16,22H,8H2,1-6H3/t15-,16-,19-/m0/s1 |
| InChIKey | JPJFQACHUZBYOA-BXWFABGCSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|