C20H31N5O2 — CID 112911230
ethyl 4-[2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112911230) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is ethyl 4-[2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112911230 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | ethyl 4-[2-[2-(cyclohexen-1-yl)ethylamino]-6-methylpyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(C)nc(NCCC3=CCCCC3)n2)CC1 |
| InChI | InChI=1S/C20H31N5O2/c1-3-27-20(26)25-13-11-24(12-14-25)18-15-16(2)22-19(23-18)21-10-9-17-7-5-4-6-8-17/h7,15H,3-6,8-14H2,1-2H3,(H,21,22,23) |
| InChIKey | VRYYSJKHKRQZOS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|