C14H16Cl2N4O — CID 112911488
2-N-(2,4-dichlorophenyl)-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 112911488) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-N-(2,4-dichlorophenyl)-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,4-dichlorophenyl)-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112911488 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-N-(2,4-dichlorophenyl)-4-N-(2-methoxyethyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | COCCNc1cc(C)nc(Nc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-9-7-13(17-5-6-21-2)20-14(18-9)19-12-4-3-10(15)8-11(12)16/h3-4,7-8H,5-6H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | ZEWFQICSCZERHX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|