C11H10ClF6NO3 — CID 11291159
ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-ethyl-1,2-oxazole-4-carboxylate (PubChem CID 11291159) has the molecular formula C11H10ClF6NO3 and a molecular weight of 353.65 g/mol. Its IUPAC name is ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-ethyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-ethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 11291159 |
| Molecular Formula | C11H10ClF6NO3 |
| Molecular Weight | 353.65 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | ethyl 5-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-3-ethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CC)noc1C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C11H10ClF6NO3/c1-3-5-6(8(20)21-4-2)7(22-19-5)9(13,14)10(15,16)11(12,17)18/h3-4H2,1-2H3 |
| InChIKey | GZCAOHICIJVVAS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|