C17H22N4O3 — CID 112912177
N-(2,4-dimethoxyphenyl)-4-methyl-6-morpholin-4-ylpyrimidin-2-amine (PubChem CID 112912177) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-methyl-6-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-methyl-6-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112912177 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-methyl-6-morpholin-4-ylpyrimidin-2-amine |
| SMILES | COc1ccc(Nc2nc(C)cc(N3CCOCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O3/c1-12-10-16(21-6-8-24-9-7-21)20-17(18-12)19-14-5-4-13(22-2)11-15(14)23-3/h4-5,10-11H,6-9H2,1-3H3,(H,18,19,20) |
| InChIKey | UXWHBZQFCPWFLT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |