C17H22N4O — CID 112912311
N-(3,5-dimethylphenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 112912311) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-(3,5-dimethylphenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112912311 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-6-methyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | Cc1cc(C)cc(Nc2cc(C)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C17H22N4O/c1-12-8-13(2)10-15(9-12)19-16-11-14(3)18-17(20-16)21-4-6-22-7-5-21/h8-11H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | YJGZYTUOVMWQMA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |