C16H30N6O — CID 112913122
2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4-diamine (PubChem CID 112913122) has the molecular formula C16H30N6O and a molecular weight of 322.46 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112913122 |
| Molecular Formula | C16H30N6O |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-6-methyl-4-N-(2-morpholin-4-ylethyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCN2CCOCC2)nc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C16H30N6O/c1-14-13-15(17-6-8-22-9-11-23-12-10-22)20-16(19-14)18-5-4-7-21(2)3/h13H,4-12H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | NCVRSEJTSKGERV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|