C20H24O6 — CID 11291363
[(3aR,5R,5aR,8aR,9S,9aR)-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] (3R)-3-hydroxy-2-methylidenebutanoate (PubChem CID 11291363) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(3aR,5R,5aR,8aR,9S,9aR)-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] (3R)-3-hydroxy-2-methylidenebutanoate.
| Compound Name | [(3aR,5R,5aR,8aR,9S,9aR)-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 11291363 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(3aR,5R,5aR,8aR,9S,9aR)-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] (3R)-3-hydroxy-2-methylidenebutanoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@@H]3C=CC(=O)[C@@]3(C)[C@@H](OC(=O)C(=C)[C@@H](C)O)[C@H]12 |
| InChI | InChI=1S/C20H24O6/c1-9-8-14-16(11(3)19(24)25-14)17(26-18(23)10(2)12(4)21)20(5)13(9)6-7-15(20)22/h6-7,9,12-14,16-17,21H,2-3,8H2,1,4-5H3/t9-,12-,13+,14-,16-,17+,20+/m1/s1 |
| InChIKey | SUQFZABZUSAQSY-MMTKZGGZSA-N |
| XLogP | 1.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|