C17H20FN5O — CID 112914652
4-[4-[(4-fluorophenyl)methylamino]-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 112914652) has the molecular formula C17H20FN5O and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methylamino]-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-[(4-fluorophenyl)methylamino]-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 112914652 |
| Molecular Formula | C17H20FN5O |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methylamino]-6-methylpyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | Cc1cc(NCc2ccc(F)cc2)nc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C17H20FN5O/c1-13-10-16(19-11-14-2-4-15(18)5-3-14)21-17(20-13)23-8-6-22(12-24)7-9-23/h2-5,10,12H,6-9,11H2,1H3,(H,19,20,21) |
| InChIKey | BUZIVWQEAVSOQO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|