C16H20N4O6 — CID 11291471
methyl N-[(2R,4aR,6S,7S,8S,8aS)-7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]carbamate (PubChem CID 11291471) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl N-[(2R,4aR,6S,7S,8S,8aS)-7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]carbamate.
| Compound Name | methyl N-[(2R,4aR,6S,7S,8S,8aS)-7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]carbamate |
|---|---|
| PubChem CID | 11291471 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl N-[(2R,4aR,6S,7S,8S,8aS)-7-azido-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]carbamate |
| SMILES | COC(=O)N[C@H]1[C@H](N=[N+]=[N-])[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C16H20N4O6/c1-22-15-12(19-20-17)11(18-16(21)23-2)13-10(25-15)8-24-14(26-13)9-6-4-3-5-7-9/h3-7,10-15H,8H2,1-2H3,(H,18,21)/t10-,11+,12+,13-,14-,15+/m1/s1 |
| InChIKey | XVJVGAGQANFFEQ-FSKVPOERSA-N |
| XLogP | 1.88 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|