C23H26O4 — CID 11291532
[(E,4S)-6-ethoxy-5-methyl-4-(3-methylphenyl)-6-oxohex-2-enyl] benzoate (PubChem CID 11291532) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is [(E,4S)-6-ethoxy-5-methyl-4-(3-methylphenyl)-6-oxohex-2-enyl] benzoate.
| Compound Name | [(E,4S)-6-ethoxy-5-methyl-4-(3-methylphenyl)-6-oxohex-2-enyl] benzoate |
|---|---|
| PubChem CID | 11291532 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(E,4S)-6-ethoxy-5-methyl-4-(3-methylphenyl)-6-oxohex-2-enyl] benzoate |
| SMILES | CCOC(=O)C(C)[C@H](/C=C/COC(=O)c1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C23H26O4/c1-4-26-22(24)18(3)21(20-13-8-10-17(2)16-20)14-9-15-27-23(25)19-11-6-5-7-12-19/h5-14,16,18,21H,4,15H2,1-3H3/b14-9+/t18?,21-/m0/s1 |
| InChIKey | FLJJLKDEGQOJEV-CDXUFJSHSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|