C18H28O8 — CID 11291707
(3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid (PubChem CID 11291707) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is (3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid.
| Compound Name | (3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid |
|---|---|
| PubChem CID | 11291707 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3S,4S,5R,8S)-8-decyl-3,4-dihydroxy-2,6-dioxo-1,7-dioxaspiro[4.4]nonane-4-carboxylic acid |
| SMILES | CCCCCCCCCC[C@H]1C[C@]2(OC(=O)[C@@H](O)[C@@]2(O)C(=O)O)C(=O)O1 |
| InChI | InChI=1S/C18H28O8/c1-2-3-4-5-6-7-8-9-10-12-11-17(16(23)25-12)18(24,15(21)22)13(19)14(20)26-17/h12-13,19,24H,2-11H2,1H3,(H,21,22)/t12-,13+,17-,18+/m0/s1 |
| InChIKey | QUSVCUTZGWKBQJ-RUZGCFLTSA-N |
| XLogP | 1.30 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|