C23H19NO4 — CID 11291750
(3aR,4S,7aS)-4-[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 11291750) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (3aR,4S,7aS)-4-[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | (3aR,4S,7aS)-4-[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 11291750 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (3aR,4S,7aS)-4-[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)[C@H]2CC=C[C@@H]([C@H]3C(=O)N(c4ccccc4)[C@@H]3c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C23H19NO4/c25-21-19(16-12-7-13-17-18(16)23(27)28-22(17)26)20(14-8-3-1-4-9-14)24(21)15-10-5-2-6-11-15/h1-12,16-20H,13H2/t16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | WALXIPUAMKQNIH-USYVTKNRSA-N |
| XLogP | 3.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|