C19H14BrF2N — CID 11291770
4-bromo-3,5-difluoro-2,6-bis(4-methylphenyl)pyridine (PubChem CID 11291770) has the molecular formula C19H14BrF2N and a molecular weight of 374.23 g/mol. Its IUPAC name is 4-bromo-3,5-difluoro-2,6-bis(4-methylphenyl)pyridine.
| Compound Name | 4-bromo-3,5-difluoro-2,6-bis(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 11291770 |
| Molecular Formula | C19H14BrF2N |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-bromo-3,5-difluoro-2,6-bis(4-methylphenyl)pyridine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)c(F)c(Br)c2F)cc1 |
| InChI | InChI=1S/C19H14BrF2N/c1-11-3-7-13(8-4-11)18-16(21)15(20)17(22)19(23-18)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | MGAVNRCICHCMOK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |