C21H23ClN4 — CID 112918090
2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine (PubChem CID 112918090) has the molecular formula C21H23ClN4 and a molecular weight of 366.90 g/mol. Its IUPAC name is 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112918090 |
| Molecular Formula | C21H23ClN4 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-N-[(4-chlorophenyl)methyl]-6-methyl-4-N-(3-phenylpropyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NCCCc2ccccc2)nc(NCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H23ClN4/c1-16-14-20(23-13-5-8-17-6-3-2-4-7-17)26-21(25-16)24-15-18-9-11-19(22)12-10-18/h2-4,6-7,9-12,14H,5,8,13,15H2,1H3,(H2,23,24,25,26) |
| InChIKey | QMQBDPVYROPWNP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|